C26H26ClNO9S3 — CID 46224497
methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;naphthalene-1,5-disulfonic acid;hydrate (PubChem CID 46224497) has the molecular formula C26H26ClNO9S3 and a molecular weight of 628.15 g/mol. Its IUPAC name is methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;naphthalene-1,5-disulfonic acid;hydrate.
| Compound Name | methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;naphthalene-1,5-disulfonic acid;hydrate |
|---|---|
| PubChem CID | 46224497 |
| Molecular Formula | C26H26ClNO9S3 |
| Molecular Weight | 628.15 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;naphthalene-1,5-disulfonic acid;hydrate |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1.O.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C16H16ClNO2S.C10H8O6S2.H2O/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;/h2-5,7,9,15H,6,8,10H2,1H3;1-6H,(H,11,12,13)(H,14,15,16);1H2/t15-;;/m0../s1 |
| InChIKey | WTALEHZDWPRFSW-CKUXDGONSA-N |
| XLogP | 4.18 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|