C23H22ClNO6S — CID 10412684
2,5-dihydroxybenzoic acid;methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate (PubChem CID 10412684) has the molecular formula C23H22ClNO6S and a molecular weight of 475.95 g/mol. Its IUPAC name is 2,5-dihydroxybenzoic acid;methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate.
| Compound Name | 2,5-dihydroxybenzoic acid;methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 10412684 |
| Molecular Formula | C23H22ClNO6S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 2,5-dihydroxybenzoic acid;methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
| SMILES | COC(=O)[C@@H](c1ccccc1Cl)N1CCc2sccc2C1.O=C(O)c1cc(O)ccc1O |
| InChI | InChI=1S/C16H16ClNO2S.C7H6O4/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;8-4-1-2-6(9)5(3-4)7(10)11/h2-5,7,9,15H,6,8,10H2,1H3;1-3,8-9H,(H,10,11)/t15-;/m1./s1 |
| InChIKey | ZCBLPKZMEHTNMS-XFULWGLBSA-N |
| XLogP | 4.47 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|