C18H22ClNO6S2 — CID 10388943
ethyl hydrogen sulfate;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate (PubChem CID 10388943) has the molecular formula C18H22ClNO6S2 and a molecular weight of 447.96 g/mol. Its IUPAC name is ethyl hydrogen sulfate;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate.
| Compound Name | ethyl hydrogen sulfate;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 10388943 |
| Molecular Formula | C18H22ClNO6S2 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | ethyl hydrogen sulfate;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
| SMILES | CCOS(=O)(=O)O.COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1 |
| InChI | InChI=1S/C16H16ClNO2S.C2H6O4S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-2-6-7(3,4)5/h2-5,7,9,15H,6,8,10H2,1H3;2H2,1H3,(H,3,4,5)/t15-;/m0./s1 |
| InChIKey | RFSWLAAQXAHCNE-RSAXXLAASA-N |
| XLogP | 3.50 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|