C25H24ClNO9S3 — CID 87767964
(2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid;naphthalene-1,2-disulfonic acid;hydrate (PubChem CID 87767964) has the molecular formula C25H24ClNO9S3 and a molecular weight of 614.12 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid;naphthalene-1,2-disulfonic acid;hydrate.
| Compound Name | (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid;naphthalene-1,2-disulfonic acid;hydrate |
|---|---|
| PubChem CID | 87767964 |
| Molecular Formula | C25H24ClNO9S3 |
| Molecular Weight | 614.12 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetic acid;naphthalene-1,2-disulfonic acid;hydrate |
| SMILES | O.O=C(O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1.O=S(=O)(O)c1ccc2ccccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C15H14ClNO2S.C10H8O6S2.H2O/c16-12-4-2-1-3-11(12)14(15(18)19)17-7-5-13-10(9-17)6-8-20-13;11-17(12,13)9-6-5-7-3-1-2-4-8(7)10(9)18(14,15)16;/h1-4,6,8,14H,5,7,9H2,(H,18,19);1-6H,(H,11,12,13)(H,14,15,16);1H2/t14-;;/m0../s1 |
| InChIKey | GPCUETGTFBPOLU-UTLKBRERSA-N |
| XLogP | 4.09 |
| TPSA | 180.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.12 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|