C19H22ClNO7S — CID 169069110
(2Z)-2-[(4S)-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(methoxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid (PubChem CID 169069110) has the molecular formula C19H22ClNO7S and a molecular weight of 443.91 g/mol. Its IUPAC name is (2Z)-2-[(4S)-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(methoxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid.
| Compound Name | (2Z)-2-[(4S)-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(methoxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 169069110 |
| Molecular Formula | C19H22ClNO7S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | (2Z)-2-[(4S)-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(methoxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid |
| SMILES | COC(=O)OCS[C@H]1CCN([C@H](C(=O)OC)c2ccccc2Cl)C/C1=C/C(=O)O |
| InChI | InChI=1S/C19H22ClNO7S/c1-26-18(24)17(13-5-3-4-6-14(13)20)21-8-7-15(12(10-21)9-16(22)23)29-11-28-19(25)27-2/h3-6,9,15,17H,7-8,10-11H2,1-2H3,(H,22,23)/b12-9-/t15-,17-/m0/s1 |
| InChIKey | FHGUBZXRHJMPQZ-UKGUVBINSA-N |
| XLogP | 3.11 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|