C23H30ClNO7S — CID 169069170
methyl (2S)-2-(2-chlorophenyl)-2-[(3E)-3-(2-ethoxy-2-oxoethylidene)-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-1-yl]acetate (PubChem CID 169069170) has the molecular formula C23H30ClNO7S and a molecular weight of 500.01 g/mol. Its IUPAC name is methyl (2S)-2-(2-chlorophenyl)-2-[(3E)-3-(2-ethoxy-2-oxoethylidene)-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-1-yl]acetate.
| Compound Name | methyl (2S)-2-(2-chlorophenyl)-2-[(3E)-3-(2-ethoxy-2-oxoethylidene)-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 169069170 |
| Molecular Formula | C23H30ClNO7S |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-[(3E)-3-(2-ethoxy-2-oxoethylidene)-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-1-yl]acetate |
| SMILES | CCOC(=O)/C=C1\CN([C@H](C(=O)OC)c2ccccc2Cl)CCC1SCOC(=O)OC(C)C |
| InChI | InChI=1S/C23H30ClNO7S/c1-5-30-20(26)12-16-13-25(11-10-19(16)33-14-31-23(28)32-15(2)3)21(22(27)29-4)17-8-6-7-9-18(17)24/h6-9,12,15,19,21H,5,10-11,13-14H2,1-4H3/b16-12+/t19?,21-/m0/s1 |
| InChIKey | BICCYDFMHKTSHB-GYLPAIASSA-N |
| XLogP | 4.37 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|