C19H23BrN2O3S2 — CID 55919570
1-(5-bromothiophen-2-yl)sulfonyl-N-phenyl-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 55919570) has the molecular formula C19H23BrN2O3S2 and a molecular weight of 471.44 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-phenyl-N-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-phenyl-N-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55919570 |
| Molecular Formula | C19H23BrN2O3S2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-phenyl-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)N(C(=O)C1CCN(S(=O)(=O)c2ccc(Br)s2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H23BrN2O3S2/c1-14(2)22(16-6-4-3-5-7-16)19(23)15-10-12-21(13-11-15)27(24,25)18-9-8-17(20)26-18/h3-9,14-15H,10-13H2,1-2H3 |
| InChIKey | AZCZPQCAJNESIJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |