C18H21BrN2O3S2 — CID 39753135
1-(5-bromothiophen-2-yl)sulfonyl-N-ethyl-N-phenylpiperidine-4-carboxamide (PubChem CID 39753135) has the molecular formula C18H21BrN2O3S2 and a molecular weight of 457.42 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-ethyl-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-ethyl-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 39753135 |
| Molecular Formula | C18H21BrN2O3S2 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-ethyl-N-phenylpiperidine-4-carboxamide |
| SMILES | CCN(C(=O)C1CCN(S(=O)(=O)c2ccc(Br)s2)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H21BrN2O3S2/c1-2-21(15-6-4-3-5-7-15)18(22)14-10-12-20(13-11-14)26(23,24)17-9-8-16(19)25-17/h3-9,14H,2,10-13H2,1H3 |
| InChIKey | MFDHXRXDZKRWOU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |