C20H23BrN2O3S — CID 42933337
1-(4-bromophenyl)sulfonyl-N-ethyl-N-phenylpiperidine-3-carboxamide (PubChem CID 42933337) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-ethyl-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-ethyl-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42933337 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-ethyl-N-phenylpiperidine-3-carboxamide |
| SMILES | CCN(C(=O)C1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-2-23(18-8-4-3-5-9-18)20(24)16-7-6-14-22(15-16)27(25,26)19-12-10-17(21)11-13-19/h3-5,8-13,16H,2,6-7,14-15H2,1H3 |
| InChIKey | WYERMGVMRCKUFJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |