C12H19BrN2O4S3 — CID 17264581
1-(5-bromothiophen-2-yl)sulfonyl-4-butylsulfonylpiperazine (PubChem CID 17264581) has the molecular formula C12H19BrN2O4S3 and a molecular weight of 431.40 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-4-butylsulfonylpiperazine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-butylsulfonylpiperazine |
|---|---|
| PubChem CID | 17264581 |
| Molecular Formula | C12H19BrN2O4S3 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-butylsulfonylpiperazine |
| SMILES | CCCCS(=O)(=O)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C12H19BrN2O4S3/c1-2-3-10-21(16,17)14-6-8-15(9-7-14)22(18,19)12-5-4-11(13)20-12/h4-5H,2-3,6-10H2,1H3 |
| InChIKey | OBDSRTDOHFYYCM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |