C15H23BrN2O3S3 — CID 60546194
1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-butylsulfanylpropan-1-one (PubChem CID 60546194) has the molecular formula C15H23BrN2O3S3 and a molecular weight of 455.47 g/mol. Its IUPAC name is 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-butylsulfanylpropan-1-one.
| Compound Name | 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-butylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 60546194 |
| Molecular Formula | C15H23BrN2O3S3 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 1-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-butylsulfanylpropan-1-one |
| SMILES | CCCCSC(C)C(=O)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C15H23BrN2O3S3/c1-3-4-11-22-12(2)15(19)17-7-9-18(10-8-17)24(20,21)14-6-5-13(16)23-14/h5-6,12H,3-4,7-11H2,1-2H3 |
| InChIKey | JNGJOMXLPHPJRW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|