C12H15BrN2O3S2 — CID 166406230
1-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 166406230) has the molecular formula C12H15BrN2O3S2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 1-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166406230 |
| Molecular Formula | C12H15BrN2O3S2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 1-[4-(5-bromothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C12H15BrN2O3S2/c1-2-11(16)14-6-3-7-15(9-8-14)20(17,18)12-5-4-10(13)19-12/h2,4-5H,1,3,6-9H2 |
| InChIKey | YSMYLGOTPBUCEC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|