C15H15BrN2O4S2 — CID 112766465
[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(4-hydroxyphenyl)methanone (PubChem CID 112766465) has the molecular formula C15H15BrN2O4S2 and a molecular weight of 431.33 g/mol. Its IUPAC name is [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 112766465 |
| Molecular Formula | C15H15BrN2O4S2 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C15H15BrN2O4S2/c16-13-5-6-14(23-13)24(21,22)18-9-7-17(8-10-18)15(20)11-1-3-12(19)4-2-11/h1-6,19H,7-10H2 |
| InChIKey | SYYLZKXEWONUIV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |