C18H18BrN3O3S2 — CID 32581697
[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylindol-3-yl)methanone (PubChem CID 32581697) has the molecular formula C18H18BrN3O3S2 and a molecular weight of 468.40 g/mol. Its IUPAC name is [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylindol-3-yl)methanone.
| Compound Name | [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylindol-3-yl)methanone |
|---|---|
| PubChem CID | 32581697 |
| Molecular Formula | C18H18BrN3O3S2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(1-methylindol-3-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)c2ccccc21 |
| InChI | InChI=1S/C18H18BrN3O3S2/c1-20-12-14(13-4-2-3-5-15(13)20)18(23)21-8-10-22(11-9-21)27(24,25)17-7-6-16(19)26-17/h2-7,12H,8-11H2,1H3 |
| InChIKey | PHVHMYGLEYGGSK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |