C16H16BrFN2O4S2 — CID 6737075
[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 6737075) has the molecular formula C16H16BrFN2O4S2 and a molecular weight of 463.35 g/mol. Its IUPAC name is [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 6737075 |
| Molecular Formula | C16H16BrFN2O4S2 |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | [4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(Br)s3)CC2)cc1F |
| InChI | InChI=1S/C16H16BrFN2O4S2/c1-24-13-3-2-11(10-12(13)18)16(21)19-6-8-20(9-7-19)26(22,23)15-5-4-14(17)25-15/h2-5,10H,6-9H2,1H3 |
| InChIKey | JJHCSIVDUUJNGK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |