C13H26N2O3S2 — CID 95338369
[1-[(2S)-2-butylsulfanylpropanoyl]piperidin-4-yl]methanesulfonamide (PubChem CID 95338369) has the molecular formula C13H26N2O3S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is [1-[(2S)-2-butylsulfanylpropanoyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | [1-[(2S)-2-butylsulfanylpropanoyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 95338369 |
| Molecular Formula | C13H26N2O3S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [1-[(2S)-2-butylsulfanylpropanoyl]piperidin-4-yl]methanesulfonamide |
| SMILES | CCCCS[C@@H](C)C(=O)N1CCC(CS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C13H26N2O3S2/c1-3-4-9-19-11(2)13(16)15-7-5-12(6-8-15)10-20(14,17)18/h11-12H,3-10H2,1-2H3,(H2,14,17,18)/t11-/m0/s1 |
| InChIKey | NREVKGCKJHXMEI-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|