C13H25NO2S — CID 78762084
2-butylsulfanyl-1-(2,6-dimethylmorpholin-4-yl)propan-1-one (PubChem CID 78762084) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 2-butylsulfanyl-1-(2,6-dimethylmorpholin-4-yl)propan-1-one.
| Compound Name | 2-butylsulfanyl-1-(2,6-dimethylmorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 78762084 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-butylsulfanyl-1-(2,6-dimethylmorpholin-4-yl)propan-1-one |
| SMILES | CCCCSC(C)C(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C13H25NO2S/c1-5-6-7-17-12(4)13(15)14-8-10(2)16-11(3)9-14/h10-12H,5-9H2,1-4H3 |
| InChIKey | LTYHLCCXHOZIAV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|