C15H25NO3S — CID 120979823
(3R,4R)-1-(2-butylsulfanylpropanoyl)-4-cyclopropylpyrrolidine-3-carboxylic acid (PubChem CID 120979823) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is (3R,4R)-1-(2-butylsulfanylpropanoyl)-4-cyclopropylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-(2-butylsulfanylpropanoyl)-4-cyclopropylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120979823 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (3R,4R)-1-(2-butylsulfanylpropanoyl)-4-cyclopropylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCSC(C)C(=O)N1C[C@H](C(=O)O)[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C15H25NO3S/c1-3-4-7-20-10(2)14(17)16-8-12(11-5-6-11)13(9-16)15(18)19/h10-13H,3-9H2,1-2H3,(H,18,19)/t10?,12-,13+/m1/s1 |
| InChIKey | XFQINLIFCOWAPJ-SOYIIFOFSA-N |
| XLogP | 2.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|