C10H20N2OS — CID 119422924
1-[4-(aminomethyl)piperidin-1-yl]-2-methylsulfanylpropan-1-one (PubChem CID 119422924) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 1-[4-(aminomethyl)piperidin-1-yl]-2-methylsulfanylpropan-1-one.
| Compound Name | 1-[4-(aminomethyl)piperidin-1-yl]-2-methylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 119422924 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-[4-(aminomethyl)piperidin-1-yl]-2-methylsulfanylpropan-1-one |
| SMILES | CSC(C)C(=O)N1CCC(CN)CC1 |
| InChI | InChI=1S/C10H20N2OS/c1-8(14-2)10(13)12-5-3-9(7-11)4-6-12/h8-9H,3-7,11H2,1-2H3 |
| InChIKey | SAZIYFJPNCDKNZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |