C17H25N3O5S2 — CID 55921436
2-butylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 55921436) has the molecular formula C17H25N3O5S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-butylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 2-butylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55921436 |
| Molecular Formula | C17H25N3O5S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-butylsulfanyl-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | CCCCSC(C)C(=O)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H25N3O5S2/c1-3-4-12-26-14(2)17(21)18-8-10-19(11-9-18)27(24,25)16-7-5-6-15(13-16)20(22)23/h5-7,13-14H,3-4,8-12H2,1-2H3 |
| InChIKey | RRLRZRGHAOQFHI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|