C16H23N3O5S — CID 110797282
1-[4-(3-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]pentan-1-one (PubChem CID 110797282) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[4-(3-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]pentan-1-one.
| Compound Name | 1-[4-(3-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 110797282 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[4-(3-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H23N3O5S/c1-2-3-8-16(20)17-9-5-10-18(12-11-17)25(23,24)15-7-4-6-14(13-15)19(21)22/h4,6-7,13H,2-3,5,8-12H2,1H3 |
| InChIKey | XAHDJQVWDMDERN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|