C13H18N4O5S — CID 2945969
N,N-dimethyl-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 2945969) has the molecular formula C13H18N4O5S and a molecular weight of 342.38 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 2945969 |
| Molecular Formula | C13H18N4O5S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N,N-dimethyl-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C13H18N4O5S/c1-14(2)13(18)15-6-8-16(9-7-15)23(21,22)12-5-3-4-11(10-12)17(19)20/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | SCBABRRJAYZIMK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|