C17H25N5O6S — CID 30863336
N-[2-(2-methylpropanoylamino)ethyl]-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 30863336) has the molecular formula C17H25N5O6S and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[2-(2-methylpropanoylamino)ethyl]-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-[2-(2-methylpropanoylamino)ethyl]-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 30863336 |
| Molecular Formula | C17H25N5O6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[2-(2-methylpropanoylamino)ethyl]-4-(3-nitrophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | CC(C)C(=O)NCCNC(=O)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H25N5O6S/c1-13(2)16(23)18-6-7-19-17(24)20-8-10-21(11-9-20)29(27,28)15-5-3-4-14(12-15)22(25)26/h3-5,12-13H,6-11H2,1-2H3,(H,18,23)(H,19,24) |
| InChIKey | GHBHILJJNWZQDB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|