C12H14ClN3O5S — CID 25323226
2-chloro-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 25323226) has the molecular formula C12H14ClN3O5S and a molecular weight of 347.78 g/mol. Its IUPAC name is 2-chloro-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 25323226 |
| Molecular Formula | C12H14ClN3O5S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2-chloro-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(CCl)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C12H14ClN3O5S/c13-9-12(17)14-4-6-15(7-5-14)22(20,21)11-3-1-2-10(8-11)16(18)19/h1-3,8H,4-7,9H2 |
| InChIKey | GLHQXTDSKLYAQX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|