C13H19ClN4O5S — CID 119265525
(2R)-2-amino-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 119265525) has the molecular formula C13H19ClN4O5S and a molecular weight of 378.84 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | (2R)-2-amino-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119265525 |
| Molecular Formula | C13H19ClN4O5S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (2R)-2-amino-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | C[C@@H](N)C(=O)N1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1.Cl |
| InChI | InChI=1S/C13H18N4O5S.ClH/c1-10(14)13(18)15-5-7-16(8-6-15)23(21,22)12-4-2-3-11(9-12)17(19)20;/h2-4,9-10H,5-8,14H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | ZQYXUEOJEZSDTK-HNCPQSOCSA-N |
| XLogP | 0.20 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|