C15H16N4O6S — CID 55339444
(5-methyl-1,2-oxazol-3-yl)-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55339444) has the molecular formula C15H16N4O6S and a molecular weight of 380.38 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55339444 |
| Molecular Formula | C15H16N4O6S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)no1 |
| InChI | InChI=1S/C15H16N4O6S/c1-11-9-14(16-25-11)15(20)17-5-7-18(8-6-17)26(23,24)13-4-2-3-12(10-13)19(21)22/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | YHEFLEFTQPOWMW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|