C17H16N4O7S — CID 19132990
[4-(benzenesulfonyl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 19132990) has the molecular formula C17H16N4O7S and a molecular weight of 420.40 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 19132990 |
| Molecular Formula | C17H16N4O7S |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H16N4O7S/c22-17(13-10-14(20(23)24)12-15(11-13)21(25)26)18-6-8-19(9-7-18)29(27,28)16-4-2-1-3-5-16/h1-5,10-12H,6-9H2 |
| InChIKey | RTXPIMWOFGQMBK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|