C19H22N4O7S2 — CID 26867736
N,N-dimethyl-3-[4-(4-nitrophenyl)sulfonylpiperazine-1-carbonyl]benzenesulfonamide (PubChem CID 26867736) has the molecular formula C19H22N4O7S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-(4-nitrophenyl)sulfonylpiperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[4-(4-nitrophenyl)sulfonylpiperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26867736 |
| Molecular Formula | C19H22N4O7S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N,N-dimethyl-3-[4-(4-nitrophenyl)sulfonylpiperazine-1-carbonyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)N2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)c1 |
| InChI | InChI=1S/C19H22N4O7S2/c1-20(2)31(27,28)18-5-3-4-15(14-18)19(24)21-10-12-22(13-11-21)32(29,30)17-8-6-16(7-9-17)23(25)26/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | MFOABEYBACYYLU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 138.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|