C17H15F2N3O5S — CID 4828680
[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 4828680) has the molecular formula C17H15F2N3O5S and a molecular weight of 411.39 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 4828680 |
| Molecular Formula | C17H15F2N3O5S |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H15F2N3O5S/c18-15-5-4-14(11-16(15)19)28(26,27)21-8-6-20(7-9-21)17(23)12-2-1-3-13(10-12)22(24)25/h1-5,10-11H,6-9H2 |
| InChIKey | NYPIDDSDGJEKSA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|