C15H19N3O9S — CID 126477351
(4-ethylsulfonylpiperazin-1-yl)-(3-nitrophenyl)methanone;oxalic acid (PubChem CID 126477351) has the molecular formula C15H19N3O9S and a molecular weight of 417.40 g/mol. Its IUPAC name is (4-ethylsulfonylpiperazin-1-yl)-(3-nitrophenyl)methanone;oxalic acid.
| Compound Name | (4-ethylsulfonylpiperazin-1-yl)-(3-nitrophenyl)methanone;oxalic acid |
|---|---|
| PubChem CID | 126477351 |
| Molecular Formula | C15H19N3O9S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (4-ethylsulfonylpiperazin-1-yl)-(3-nitrophenyl)methanone;oxalic acid |
| SMILES | CCS(=O)(=O)N1CCN(C(=O)c2cccc([N+](=O)[O-])c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H17N3O5S.C2H2O4/c1-2-22(20,21)15-8-6-14(7-9-15)13(17)11-4-3-5-12(10-11)16(18)19;3-1(4)2(5)6/h3-5,10H,2,6-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OUHGEBLNLBGEMN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 175.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|