C15H18N4O9 — CID 18590544
(3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone;oxalic acid (PubChem CID 18590544) has the molecular formula C15H18N4O9 and a molecular weight of 398.33 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone;oxalic acid.
| Compound Name | (3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone;oxalic acid |
|---|---|
| PubChem CID | 18590544 |
| Molecular Formula | C15H18N4O9 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone;oxalic acid |
| SMILES | CCN1CCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H16N4O5.C2H2O4/c1-2-14-3-5-15(6-4-14)13(18)10-7-11(16(19)20)9-12(8-10)17(21)22;3-1(4)2(5)6/h7-9H,2-6H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | IJGHEKWVUZEMMX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 184.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|