C26H32N8O10 — CID 159376289
(3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone (PubChem CID 159376289) has the molecular formula C26H32N8O10 and a molecular weight of 616.59 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | (3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 159376289 |
| Molecular Formula | C26H32N8O10 |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | (3,5-dinitrophenyl)-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1.CCN1CCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/2C13H16N4O5/c2*1-2-14-3-5-15(6-4-14)13(18)10-7-11(16(19)20)9-12(8-10)17(21)22/h2*7-9H,2-6H2,1H3 |
| InChIKey | LKIWYYZGJGTPGS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 219.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|