C15H18N4O6 — CID 87030556
1-[4-(3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 87030556) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is 1-[4-(3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 87030556 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[4-(3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C15H18N4O6/c1-2-14(20)16-4-3-5-17(7-6-16)15(21)11-8-12(18(22)23)10-13(9-11)19(24)25/h8-10H,2-7H2,1H3 |
| InChIKey | YWSWOFCCTBIOPH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|