C12H15ClN4O5 — CID 110168691
(3,5-dinitrophenyl)-(4-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 110168691) has the molecular formula C12H15ClN4O5 and a molecular weight of 330.73 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-(4-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (3,5-dinitrophenyl)-(4-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 110168691 |
| Molecular Formula | C12H15ClN4O5 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (3,5-dinitrophenyl)-(4-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CN1CCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1.Cl |
| InChI | InChI=1S/C12H14N4O5.ClH/c1-13-2-4-14(5-3-13)12(17)9-6-10(15(18)19)8-11(7-9)16(20)21;/h6-8H,2-5H2,1H3;1H |
| InChIKey | KUOCLINIALKRPV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|