C14H18ClN3O5 — CID 20544741
(4-methylpiperazin-1-yl)-(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride (PubChem CID 20544741) has the molecular formula C14H18ClN3O5 and a molecular weight of 343.77 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride.
| Compound Name | (4-methylpiperazin-1-yl)-(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 20544741 |
| Molecular Formula | C14H18ClN3O5 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(7-nitro-2,3-dihydro-1,4-benzodioxin-5-yl)methanone;hydrochloride |
| SMILES | CN1CCN(C(=O)c2cc([N+](=O)[O-])cc3c2OCCO3)CC1.Cl |
| InChI | InChI=1S/C14H17N3O5.ClH/c1-15-2-4-16(5-3-15)14(18)11-8-10(17(19)20)9-12-13(11)22-7-6-21-12;/h8-9H,2-7H2,1H3;1H |
| InChIKey | GLXPZOKJSURFLL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|