C12H13N3O6 — CID 3642904
(2-methyl-3,5-dinitrophenyl)-morpholin-4-ylmethanone (PubChem CID 3642904) has the molecular formula C12H13N3O6 and a molecular weight of 295.25 g/mol. Its IUPAC name is (2-methyl-3,5-dinitrophenyl)-morpholin-4-ylmethanone.
| Compound Name | (2-methyl-3,5-dinitrophenyl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 3642904 |
| Molecular Formula | C12H13N3O6 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (2-methyl-3,5-dinitrophenyl)-morpholin-4-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCOCC2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O6/c1-8-10(12(16)13-2-4-21-5-3-13)6-9(14(17)18)7-11(8)15(19)20/h6-7H,2-5H2,1H3 |
| InChIKey | NWRSNWTUZJLEIV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|