C20H21ClN4O6 — CID 78853002
[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-(2-methyl-3,5-dinitrophenyl)methanone (PubChem CID 78853002) has the molecular formula C20H21ClN4O6 and a molecular weight of 448.86 g/mol. Its IUPAC name is [4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-(2-methyl-3,5-dinitrophenyl)methanone.
| Compound Name | [4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-(2-methyl-3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 78853002 |
| Molecular Formula | C20H21ClN4O6 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-(2-methyl-3,5-dinitrophenyl)methanone |
| SMILES | COc1ccc(Cl)cc1CN1CCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2C)CC1 |
| InChI | InChI=1S/C20H21ClN4O6/c1-13-17(10-16(24(27)28)11-18(13)25(29)30)20(26)23-7-5-22(6-8-23)12-14-9-15(21)3-4-19(14)31-2/h3-4,9-11H,5-8,12H2,1-2H3 |
| InChIKey | YCQYIBQFRNIMOL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|