C12H12N3O6- — CID 7038377
2,4-dinitro-6-(piperidine-1-carbonyl)phenolate (PubChem CID 7038377) has the molecular formula C12H12N3O6- and a molecular weight of 294.24 g/mol. Its IUPAC name is 2,4-dinitro-6-(piperidine-1-carbonyl)phenolate.
| Compound Name | 2,4-dinitro-6-(piperidine-1-carbonyl)phenolate |
|---|---|
| PubChem CID | 7038377 |
| Molecular Formula | C12H12N3O6- |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2,4-dinitro-6-(piperidine-1-carbonyl)phenolate |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-])N1CCCCC1 |
| InChI | InChI=1S/C12H13N3O6/c16-11-9(12(17)13-4-2-1-3-5-13)6-8(14(18)19)7-10(11)15(20)21/h6-7,16H,1-5H2/p-1 |
| InChIKey | YZSRNGHESVCCEX-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|