C22H20ClN3O7 — CID 108726134
6-chloro-8-methyl-1'-(2-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108726134) has the molecular formula C22H20ClN3O7 and a molecular weight of 473.87 g/mol. Its IUPAC name is 6-chloro-8-methyl-1'-(2-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-8-methyl-1'-(2-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108726134 |
| Molecular Formula | C22H20ClN3O7 |
| Molecular Weight | 473.87 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 6-chloro-8-methyl-1'-(2-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(Cl)cc2c1OC1(CCN(C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3C)CC1)CC2=O |
| InChI | InChI=1S/C22H20ClN3O7/c1-12-7-14(23)8-17-19(27)11-22(33-20(12)17)3-5-24(6-4-22)21(28)16-9-15(25(29)30)10-18(13(16)2)26(31)32/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | SWCOMNIMCXYVIC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|