C21H17Cl2N3O7 — CID 108735508
6,8-dichloro-1'-(4-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108735508) has the molecular formula C21H17Cl2N3O7 and a molecular weight of 494.29 g/mol. Its IUPAC name is 6,8-dichloro-1'-(4-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6,8-dichloro-1'-(4-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108735508 |
| Molecular Formula | C21H17Cl2N3O7 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 6,8-dichloro-1'-(4-methyl-3,5-dinitrobenzoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)N2CCC3(CC2)CC(=O)c2cc(Cl)cc(Cl)c2O3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17Cl2N3O7/c1-11-16(25(29)30)6-12(7-17(11)26(31)32)20(28)24-4-2-21(3-5-24)10-18(27)14-8-13(22)9-15(23)19(14)33-21/h6-9H,2-5,10H2,1H3 |
| InChIKey | NCQKTAQVLUGTJX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|