C21H18Cl2N2O5 — CID 108726234
6-chloro-1'-(4-chloro-2-nitrobenzoyl)-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108726234) has the molecular formula C21H18Cl2N2O5 and a molecular weight of 449.29 g/mol. Its IUPAC name is 6-chloro-1'-(4-chloro-2-nitrobenzoyl)-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-1'-(4-chloro-2-nitrobenzoyl)-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108726234 |
| Molecular Formula | C21H18Cl2N2O5 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 6-chloro-1'-(4-chloro-2-nitrobenzoyl)-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(Cl)cc2c1OC1(CCN(C(=O)c3ccc(Cl)cc3[N+](=O)[O-])CC1)CC2=O |
| InChI | InChI=1S/C21H18Cl2N2O5/c1-12-8-14(23)9-16-18(26)11-21(30-19(12)16)4-6-24(7-5-21)20(27)15-3-2-13(22)10-17(15)25(28)29/h2-3,8-10H,4-7,11H2,1H3 |
| InChIKey | LDPZZWQOJZJVTO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|