C21H20ClNO3 — CID 108726147
1'-benzoyl-6-chloro-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108726147) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is 1'-benzoyl-6-chloro-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-benzoyl-6-chloro-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108726147 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1'-benzoyl-6-chloro-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(Cl)cc2c1OC1(CCN(C(=O)c3ccccc3)CC1)CC2=O |
| InChI | InChI=1S/C21H20ClNO3/c1-14-11-16(22)12-17-18(24)13-21(26-19(14)17)7-9-23(10-8-21)20(25)15-5-3-2-4-6-15/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | IWTUULQLQSUCOU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |