C20H18ClNO3 — CID 100761498
1'-benzoyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 100761498) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 1'-benzoyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-benzoyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 100761498 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1'-benzoyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCN(C(=O)c3ccccc3)CC2)Oc2c(Cl)cccc21 |
| InChI | InChI=1S/C20H18ClNO3/c21-16-8-4-7-15-17(23)13-20(25-18(15)16)9-11-22(12-10-20)19(24)14-5-2-1-3-6-14/h1-8H,9-13H2 |
| InChIKey | MBZUXNGTIPHAJV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |