C22H19Cl2NO5 — CID 108758625
[3-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate (PubChem CID 108758625) has the molecular formula C22H19Cl2NO5 and a molecular weight of 448.30 g/mol. Its IUPAC name is [3-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate.
| Compound Name | [3-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate |
|---|---|
| PubChem CID | 108758625 |
| Molecular Formula | C22H19Cl2NO5 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [3-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCC3(CC2)CC(=O)c2cc(Cl)cc(Cl)c2O3)c1 |
| InChI | InChI=1S/C22H19Cl2NO5/c1-13(26)29-16-4-2-3-14(9-16)21(28)25-7-5-22(6-8-25)12-19(27)17-10-15(23)11-18(24)20(17)30-22/h2-4,9-11H,5-8,12H2,1H3 |
| InChIKey | IPULTTPDLVOVHA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|