C18H20Cl3NO3 — CID 108758629
6,8-dichloro-1'-(3-chloro-2,2-dimethylpropanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108758629) has the molecular formula C18H20Cl3NO3 and a molecular weight of 404.72 g/mol. Its IUPAC name is 6,8-dichloro-1'-(3-chloro-2,2-dimethylpropanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6,8-dichloro-1'-(3-chloro-2,2-dimethylpropanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108758629 |
| Molecular Formula | C18H20Cl3NO3 |
| Molecular Weight | 404.72 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 6,8-dichloro-1'-(3-chloro-2,2-dimethylpropanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CC(C)(CCl)C(=O)N1CCC2(CC1)CC(=O)c1cc(Cl)cc(Cl)c1O2 |
| InChI | InChI=1S/C18H20Cl3NO3/c1-17(2,10-19)16(24)22-5-3-18(4-6-22)9-14(23)12-7-11(20)8-13(21)15(12)25-18/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | OLTNGQWVMAWZFG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|