C23H26Cl2N4O3 — CID 108810218
6,8-dichloro-1'-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108810218) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is 6,8-dichloro-1'-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6,8-dichloro-1'-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108810218 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 6,8-dichloro-1'-[4-[(4,6-dimethylpyrimidin-2-yl)amino]butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(C)nc(NCCCC(=O)N2CCC3(CC2)CC(=O)c2cc(Cl)cc(Cl)c2O3)n1 |
| InChI | InChI=1S/C23H26Cl2N4O3/c1-14-10-15(2)28-22(27-14)26-7-3-4-20(31)29-8-5-23(6-9-29)13-19(30)17-11-16(24)12-18(25)21(17)32-23/h10-12H,3-9,13H2,1-2H3,(H,26,27,28) |
| InChIKey | RVQDBNHQAXNUJQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|