C13H12Cl2O2 — CID 165352507
6,8-dichlorospiro[3H-chromene-2,1'-cyclopentane]-4-one (PubChem CID 165352507) has the molecular formula C13H12Cl2O2 and a molecular weight of 271.14 g/mol. Its IUPAC name is 6,8-dichlorospiro[3H-chromene-2,1'-cyclopentane]-4-one.
| Compound Name | 6,8-dichlorospiro[3H-chromene-2,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 165352507 |
| Molecular Formula | C13H12Cl2O2 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 6,8-dichlorospiro[3H-chromene-2,1'-cyclopentane]-4-one |
| SMILES | O=C1CC2(CCCC2)Oc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C13H12Cl2O2/c14-8-5-9-11(16)7-13(3-1-2-4-13)17-12(9)10(15)6-8/h5-6H,1-4,7H2 |
| InChIKey | UFTQTHJPPXYTFO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |