C24H20Cl2N2O5 — CID 108758656
2-[1-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 108758656) has the molecular formula C24H20Cl2N2O5 and a molecular weight of 487.34 g/mol. Its IUPAC name is 2-[1-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108758656 |
| Molecular Formula | C24H20Cl2N2O5 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-[1-(6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCC2(CC1)CC(=O)c1cc(Cl)cc(Cl)c1O2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H20Cl2N2O5/c1-13(28-22(31)15-4-2-3-5-16(15)23(28)32)21(30)27-8-6-24(7-9-27)12-19(29)17-10-14(25)11-18(26)20(17)33-24/h2-5,10-11,13H,6-9,12H2,1H3 |
| InChIKey | JHJGSOMFBUWPET-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|