C23H17Cl2NO5 — CID 108735479
6,8-dichloro-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108735479) has the molecular formula C23H17Cl2NO5 and a molecular weight of 458.30 g/mol. Its IUPAC name is 6,8-dichloro-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6,8-dichloro-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108735479 |
| Molecular Formula | C23H17Cl2NO5 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 6,8-dichloro-1'-(2-oxochromene-3-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCN(C(=O)c3cc4ccccc4oc3=O)CC2)Oc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C23H17Cl2NO5/c24-14-10-15-18(27)12-23(31-20(15)17(25)11-14)5-7-26(8-6-23)21(28)16-9-13-3-1-2-4-19(13)30-22(16)29/h1-4,9-11H,5-8,12H2 |
| InChIKey | GPGFNDQSDGTEEV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|