C17H17Cl2NO4 — CID 108735528
prop-2-enyl 6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 108735528) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is prop-2-enyl 6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | prop-2-enyl 6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 108735528 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | prop-2-enyl 6,8-dichloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | C=CCOC(=O)N1CCC2(CC1)CC(=O)c1cc(Cl)cc(Cl)c1O2 |
| InChI | InChI=1S/C17H17Cl2NO4/c1-2-7-23-16(22)20-5-3-17(4-6-20)10-14(21)12-8-11(18)9-13(19)15(12)24-17/h2,8-9H,1,3-7,10H2 |
| InChIKey | OPNDYQKFVLXROJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|